About N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride
N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride (PubChem CID 44656239) has the molecular formula C19H29ClN2O3
and a molecular weight of 368.91 g/mol. Its IUPAC name is N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride.
Molecular Properties
| Compound Name | N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride |
| PubChem CID | 44656239 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride |
| SMILES | CCCCc1cc2c(cc1NC(=O)C[NH+]1CCCCC1)OCCO2.[Cl-] |
| InChI | InChI=1S/C19H28N2O3.ClH/c1-2-3-7-15-12-17-18(24-11-10-23-17)13-16(15)20-19(22)14-21-8-5-4-6-9-21;/h12-13H,2-11,14H2,1H3,(H,20,22);1H |
| InChIKey | GUCQXHUITAENCX-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride?
The IUPAC name of N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride (CID 44656239) is N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride.
What is the SMILES notation for N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride?
The canonical SMILES for N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride is CCCCc1cc2c(cc1NC(=O)C[NH+]1CCCCC1)OCCO2.[Cl-].
What is the InChIKey of N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride?
The InChIKey is GUCQXHUITAENCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O3.ClH/c1-2-3-7-15-12-17-18(24-11-10-23-17)13-16(15)20-19(22)14-21-8-5-4-6-9-21;/h12-13H,2-11,14H2,1H3,(H,20,22);1H.
What are the key properties of N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride?
N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride has a molecular weight of 368.91 g/mol, XLogP of -1.19, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-butyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-piperidin-1-ium-1-ylacetamide chloride is sourced from PubChem (CID 44656239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).