C24H32INO3S — CID 44656281
[(1S,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 5-(benzylsulfanylmethyl)furan-2-carboxylate iodide (PubChem CID 44656281) has the molecular formula C24H32INO3S and a molecular weight of 541.50 g/mol. Its IUPAC name is [(1S,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 5-(benzylsulfanylmethyl)furan-2-carboxylate iodide.
| Compound Name | [(1S,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 5-(benzylsulfanylmethyl)furan-2-carboxylate iodide |
|---|---|
| PubChem CID | 44656281 |
| Molecular Formula | C24H32INO3S |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | [(1S,9aS)-5-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-5-ium-1-yl]methyl 5-(benzylsulfanylmethyl)furan-2-carboxylate iodide |
| SMILES | C[N+]12CCCC[C@H]1[C@@H](COC(=O)c1ccc(CSCc3ccccc3)o1)CCC2.[I-] |
| InChI | InChI=1S/C24H32NO3S.HI/c1-25-14-6-5-11-22(25)20(10-7-15-25)16-27-24(26)23-13-12-21(28-23)18-29-17-19-8-3-2-4-9-19;/h2-4,8-9,12-13,20,22H,5-7,10-11,14-18H2,1H3;1H/q+1;/p-1/t20-,22+,25?;/m1./s1 |
| InChIKey | UPNOXQLONNNQMC-LJLBQCSYSA-M |
| XLogP | 2.28 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|