About 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride
4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride (PubChem CID 44656530) has the molecular formula C15H22Cl2N4O
and a molecular weight of 345.27 g/mol. Its IUPAC name is 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride.
Molecular Properties
| Compound Name | 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride |
| PubChem CID | 44656530 |
| Molecular Formula | C15H22Cl2N4O |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride |
| SMILES | [Cl-].[Cl-].c1ccc2c(c1)n(CC[NH+]1CCOCC1)c1[n+]2CCN1 |
| InChI | InChI=1S/C15H20N4O.2ClH/c1-2-4-14-13(3-1)18-6-5-16-15(18)19(14)8-7-17-9-11-20-12-10-17;;/h1-4H,5-12H2;2*1H |
| InChIKey | AGAGWGWWCUPTJG-UHFFFAOYSA-N |
| XLogP | -6.72 |
| TPSA | 34.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | -6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride?
The IUPAC name of 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride (CID 44656530) is 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride.
What is the SMILES notation for 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride?
The canonical SMILES for 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride is [Cl-].[Cl-].c1ccc2c(c1)n(CC[NH+]1CCOCC1)c1[n+]2CCN1.
What is the InChIKey of 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride?
The InChIKey is AGAGWGWWCUPTJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O.2ClH/c1-2-4-14-13(3-1)18-6-5-16-15(18)19(14)8-7-17-9-11-20-12-10-17;;/h1-4H,5-12H2;2*1H.
What are the key properties of 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride?
4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride has a molecular weight of 345.27 g/mol, XLogP of -6.72, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)ethyl]morpholin-4-ium dichloride is sourced from PubChem (CID 44656530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).