C27H39ClN2O3 — CID 44656730
(1R,3S,4R,8R,10R,14S)-5-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one chloride (PubChem CID 44656730) has the molecular formula C27H39ClN2O3 and a molecular weight of 475.07 g/mol. Its IUPAC name is (1R,3S,4R,8R,10R,14S)-5-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one chloride.
| Compound Name | (1R,3S,4R,8R,10R,14S)-5-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one chloride |
|---|---|
| PubChem CID | 44656730 |
| Molecular Formula | C27H39ClN2O3 |
| Molecular Weight | 475.07 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (1R,3S,4R,8R,10R,14S)-5-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one chloride |
| SMILES | Cc1cccc(N2CC[NH+](CC3C(=O)O[C@@H]4C[C@@]5(C)CCC[C@H](C)[C@@]56O[C@H]6[C@H]34)CC2)c1C.[Cl-] |
| InChI | InChI=1S/C27H38N2O3.ClH/c1-17-7-5-9-21(19(17)3)29-13-11-28(12-14-29)16-20-23-22(31-25(20)30)15-26(4)10-6-8-18(2)27(26)24(23)32-27;/h5,7,9,18,20,22-24H,6,8,10-16H2,1-4H3;1H/t18-,20?,22+,23+,24-,26+,27-;/m0./s1 |
| InChIKey | KOQSGDRBNNIYNZ-WRFNVDMFSA-N |
| XLogP | -0.46 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.07 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|