About 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide
1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide (PubChem CID 44656837) has the molecular formula C18H18BrN3O4
and a molecular weight of 420.26 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide.
Molecular Properties
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide |
| PubChem CID | 44656837 |
| Molecular Formula | C18H18BrN3O4 |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide |
| SMILES | O=C(C[n+]1c(NCCO)[nH]c2ccccc21)c1ccc2c(c1)OCO2.[Br-] |
| InChI | InChI=1S/C18H17N3O4.BrH/c22-8-7-19-18-20-13-3-1-2-4-14(13)21(18)10-15(23)12-5-6-16-17(9-12)25-11-24-16;/h1-6,9,22H,7-8,10-11H2,(H,19,20);1H |
| InChIKey | PHCNJZSTDWTWKD-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide?
The IUPAC name of 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide (CID 44656837) is 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide.
What is the SMILES notation for 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide?
The canonical SMILES for 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide is O=C(C[n+]1c(NCCO)[nH]c2ccccc21)c1ccc2c(c1)OCO2.[Br-].
What is the InChIKey of 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide?
The InChIKey is PHCNJZSTDWTWKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O4.BrH/c22-8-7-19-18-20-13-3-1-2-4-14(13)21(18)10-15(23)12-5-6-16-17(9-12)25-11-24-16;/h1-6,9,22H,7-8,10-11H2,(H,19,20);1H.
What are the key properties of 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide?
1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide has a molecular weight of 420.26 g/mol, XLogP of -1.52, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzodioxol-5-yl)-2-[2-(2-hydroxyethylamino)-3H-benzimidazol-1-ium-1-yl]ethanone bromide is sourced from PubChem (CID 44656837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).