C17H16BrN5OS — CID 44657420
N-[4-[2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]phenyl]acetamide;hydrobromide (PubChem CID 44657420) has the molecular formula C17H16BrN5OS and a molecular weight of 418.32 g/mol. Its IUPAC name is N-[4-[2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]phenyl]acetamide;hydrobromide.
| Compound Name | N-[4-[2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]phenyl]acetamide;hydrobromide |
|---|---|
| PubChem CID | 44657420 |
| Molecular Formula | C17H16BrN5OS |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | N-[4-[2-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]phenyl]acetamide;hydrobromide |
| SMILES | Br.CC(=O)Nc1ccc(-c2csc(N/N=C\c3ccncc3)n2)cc1 |
| InChI | InChI=1S/C17H15N5OS.BrH/c1-12(23)20-15-4-2-14(3-5-15)16-11-24-17(21-16)22-19-10-13-6-8-18-9-7-13;/h2-11H,1H3,(H,20,23)(H,21,22);1H/b19-10-; |
| InChIKey | IMFVLWLGNHNKFR-PEZBNFGJSA-N |
| XLogP | 4.19 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|