C32H42N2O6 — CID 44657553
methyl 2-[[2-[(Z)-[(17R)-17-acetyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-2-phenylacetate (PubChem CID 44657553) has the molecular formula C32H42N2O6 and a molecular weight of 550.70 g/mol. Its IUPAC name is methyl 2-[[2-[(Z)-[(17R)-17-acetyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-2-phenylacetate.
| Compound Name | methyl 2-[[2-[(Z)-[(17R)-17-acetyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 44657553 |
| Molecular Formula | C32H42N2O6 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | methyl 2-[[2-[(Z)-[(17R)-17-acetyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetyl]amino]-2-phenylacetate |
| SMILES | COC(=O)C(NC(=O)CO/N=C1\C=C2CCC3C(CCC4(C)C3CC[C@]4(O)C(C)=O)C2(C)CC1)c1ccccc1 |
| InChI | InChI=1S/C32H42N2O6/c1-20(35)32(38)17-14-26-24-11-10-22-18-23(12-15-30(22,2)25(24)13-16-31(26,32)3)34-40-19-27(36)33-28(29(37)39-4)21-8-6-5-7-9-21/h5-9,18,24-26,28,38H,10-17,19H2,1-4H3,(H,33,36)/b34-23-/t24?,25?,26?,28?,30?,31?,32-/m0/s1 |
| InChIKey | PTNIEZIDVYVAQH-CLHYURJZSA-N |
| XLogP | 4.67 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|