C17H24ClN — CID 44657953
4-(1-adamantyl)-2,6-dimethylpyridine;hydrochloride (PubChem CID 44657953) has the molecular formula C17H24ClN and a molecular weight of 277.84 g/mol. Its IUPAC name is 4-(1-adamantyl)-2,6-dimethylpyridine;hydrochloride.
| Compound Name | 4-(1-adamantyl)-2,6-dimethylpyridine;hydrochloride |
|---|---|
| PubChem CID | 44657953 |
| Molecular Formula | C17H24ClN |
| Molecular Weight | 277.84 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 4-(1-adamantyl)-2,6-dimethylpyridine;hydrochloride |
| SMILES | Cc1cc(C23CC4CC(CC(C4)C2)C3)cc(C)n1.Cl |
| InChI | InChI=1S/C17H23N.ClH/c1-11-3-16(4-12(2)18-11)17-8-13-5-14(9-17)7-15(6-13)10-17;/h3-4,13-15H,5-10H2,1-2H3;1H |
| InChIKey | WMKCWOUDKIUKMA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.84 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |