C28H40N4O4 — CID 44657986
2-[(Z)-[(17R)-17-acetyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-[2-(1H-imidazol-5-yl)ethyl]acetamide (PubChem CID 44657986) has the molecular formula C28H40N4O4 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-[(Z)-[(17R)-17-acetyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-[2-(1H-imidazol-5-yl)ethyl]acetamide.
| Compound Name | 2-[(Z)-[(17R)-17-acetyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-[2-(1H-imidazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 44657986 |
| Molecular Formula | C28H40N4O4 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 2-[(Z)-[(17R)-17-acetyl-17-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-[2-(1H-imidazol-5-yl)ethyl]acetamide |
| SMILES | CC(=O)[C@@]1(O)CCC2C3CCC4=C/C(=N\OCC(=O)NCCc5cnc[nH]5)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C28H40N4O4/c1-18(33)28(35)12-8-24-22-5-4-19-14-20(6-10-26(19,2)23(22)7-11-27(24,28)3)32-36-16-25(34)30-13-9-21-15-29-17-31-21/h14-15,17,22-24,35H,4-13,16H2,1-3H3,(H,29,31)(H,30,34)/b32-20-/t22?,23?,24?,26?,27?,28-/m0/s1 |
| InChIKey | OTISSVUPJCZLPE-CEFVXXRBSA-N |
| XLogP | 3.72 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|