C19H34ClNO — CID 44658087
[(3R,5S,17R)-17-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]azanium chloride (PubChem CID 44658087) has the molecular formula C19H34ClNO and a molecular weight of 327.94 g/mol. Its IUPAC name is [(3R,5S,17R)-17-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]azanium chloride.
| Compound Name | [(3R,5S,17R)-17-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]azanium chloride |
|---|---|
| PubChem CID | 44658087 |
| Molecular Formula | C19H34ClNO |
| Molecular Weight | 327.94 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | [(3R,5S,17R)-17-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]azanium chloride |
| SMILES | CC12CC[C@@H]([NH3+])C[C@@H]1CCC1C2CCC2(C)C1CC[C@H]2O.[Cl-] |
| InChI | InChI=1S/C19H33NO.ClH/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18;/h12-17,21H,3-11,20H2,1-2H3;1H/t12-,13+,14?,15?,16?,17+,18?,19?;/m0./s1 |
| InChIKey | GYQZNNAZXVKYOR-YHGFUEDJSA-N |
| XLogP | 0.00 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.94 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |