About 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride
2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride (PubChem CID 44658476) has the molecular formula C10H13ClN2O
and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride.
Molecular Properties
| Compound Name | 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride |
| PubChem CID | 44658476 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride |
| SMILES | NC1=[N+](c2ccccc2O)CCC1.[Cl-] |
| InChI | InChI=1S/C10H12N2O.ClH/c11-10-6-3-7-12(10)8-4-1-2-5-9(8)13;/h1-2,4-5,11,13H,3,6-7H2;1H |
| InChIKey | IIRTUXANYNDPIS-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 49.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride?
The IUPAC name of 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride (CID 44658476) is 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride.
What is the SMILES notation for 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride?
The canonical SMILES for 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride is NC1=[N+](c2ccccc2O)CCC1.[Cl-].
What is the InChIKey of 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride?
The InChIKey is IIRTUXANYNDPIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O.ClH/c11-10-6-3-7-12(10)8-4-1-2-5-9(8)13;/h1-2,4-5,11,13H,3,6-7H2;1H.
What are the key properties of 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride?
2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride has a molecular weight of 212.68 g/mol, XLogP of -1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-3,4-dihydro-2H-pyrrol-1-ium-1-yl)phenol chloride is sourced from PubChem (CID 44658476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).