C22H26ClN3O3 — CID 44658593
diethyl-[2-(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-yl)ethyl]azanium chloride (PubChem CID 44658593) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is diethyl-[2-(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-yl)ethyl]azanium chloride.
| Compound Name | diethyl-[2-(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-yl)ethyl]azanium chloride |
|---|---|
| PubChem CID | 44658593 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | diethyl-[2-(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-yl)ethyl]azanium chloride |
| SMILES | CC[NH+](CC)CCC1C(=O)N(c2ccccc2)C(=O)N(c2ccccc2)C1=O.[Cl-] |
| InChI | InChI=1S/C22H25N3O3.ClH/c1-3-23(4-2)16-15-19-20(26)24(17-11-7-5-8-12-17)22(28)25(21(19)27)18-13-9-6-10-14-18;/h5-14,19H,3-4,15-16H2,1-2H3;1H |
| InChIKey | GLLZMLKRZOKGGY-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|