C21H25IN2O4 — CID 44659220
4-methoxy-6,6-dimethyl-N-(2-methylphenyl)-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-carboxamide iodide (PubChem CID 44659220) has the molecular formula C21H25IN2O4 and a molecular weight of 496.35 g/mol. Its IUPAC name is 4-methoxy-6,6-dimethyl-N-(2-methylphenyl)-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-carboxamide iodide.
| Compound Name | 4-methoxy-6,6-dimethyl-N-(2-methylphenyl)-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-carboxamide iodide |
|---|---|
| PubChem CID | 44659220 |
| Molecular Formula | C21H25IN2O4 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 4-methoxy-6,6-dimethyl-N-(2-methylphenyl)-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-5-carboxamide iodide |
| SMILES | COc1c2c(cc3c1C(C(=O)Nc1ccccc1C)[N+](C)(C)CC3)OCO2.[I-] |
| InChI | InChI=1S/C21H24N2O4.HI/c1-13-7-5-6-8-15(13)22-21(24)18-17-14(9-10-23(18,2)3)11-16-19(20(17)25-4)27-12-26-16;/h5-8,11,18H,9-10,12H2,1-4H3;1H |
| InChIKey | YMLIJMWEDKXVDV-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|