C13H13IN4OS — CID 44660138
1-(6-methyl-1H-indol-3-yl)-2-(1,3,4-thiadiazol-2-ylamino)ethanone;hydroiodide (PubChem CID 44660138) has the molecular formula C13H13IN4OS and a molecular weight of 400.25 g/mol. Its IUPAC name is 1-(6-methyl-1H-indol-3-yl)-2-(1,3,4-thiadiazol-2-ylamino)ethanone;hydroiodide.
| Compound Name | 1-(6-methyl-1H-indol-3-yl)-2-(1,3,4-thiadiazol-2-ylamino)ethanone;hydroiodide |
|---|---|
| PubChem CID | 44660138 |
| Molecular Formula | C13H13IN4OS |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | 1-(6-methyl-1H-indol-3-yl)-2-(1,3,4-thiadiazol-2-ylamino)ethanone;hydroiodide |
| SMILES | Cc1ccc2c(C(=O)CNc3nncs3)c[nH]c2c1.I |
| InChI | InChI=1S/C13H12N4OS.HI/c1-8-2-3-9-10(5-14-11(9)4-8)12(18)6-15-13-17-16-7-19-13;/h2-5,7,14H,6H2,1H3,(H,15,17);1H |
| InChIKey | AQBUDGGTDJYEAA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|