About [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate
[1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate (PubChem CID 44660940) has the molecular formula C13H28NO7P
and a molecular weight of 341.34 g/mol. Its IUPAC name is [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate.
Molecular Properties
| Compound Name | [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate |
| PubChem CID | 44660940 |
| Molecular Formula | C13H28NO7P |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate |
| SMILES | CC(C)CC([NH3+])P(=O)(OC(C)C)OC(C)C.O=C([O-])C(=O)O |
| InChI | InChI=1S/C11H26NO3P.C2H2O4/c1-8(2)7-11(12)16(13,14-9(3)4)15-10(5)6;3-1(4)2(5)6/h8-11H,7,12H2,1-6H3;(H,3,4)(H,5,6) |
| InChIKey | XIYUYEKSNGDYIG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 140.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate?
The IUPAC name of [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate (CID 44660940) is [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate.
What is the SMILES notation for [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate?
The canonical SMILES for [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate is CC(C)CC([NH3+])P(=O)(OC(C)C)OC(C)C.O=C([O-])C(=O)O.
What is the InChIKey of [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate?
The InChIKey is XIYUYEKSNGDYIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26NO3P.C2H2O4/c1-8(2)7-11(12)16(13,14-9(3)4)15-10(5)6;3-1(4)2(5)6/h8-11H,7,12H2,1-6H3;(H,3,4)(H,5,6).
What are the key properties of [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate?
[1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate has a molecular weight of 341.34 g/mol, XLogP of 0.46, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-di(propan-2-yloxy)phosphoryl-3-methylbutyl]azanium;2-hydroxy-2-oxoacetate is sourced from PubChem (CID 44660940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).