C15H20Cl2N4O2S — CID 44662606
5-[5-[2-(3-chloroanilino)-2-oxoethyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentylazanium chloride (PubChem CID 44662606) has the molecular formula C15H20Cl2N4O2S and a molecular weight of 391.32 g/mol. Its IUPAC name is 5-[5-[2-(3-chloroanilino)-2-oxoethyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentylazanium chloride.
| Compound Name | 5-[5-[2-(3-chloroanilino)-2-oxoethyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentylazanium chloride |
|---|---|
| PubChem CID | 44662606 |
| Molecular Formula | C15H20Cl2N4O2S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 5-[5-[2-(3-chloroanilino)-2-oxoethyl]sulfanyl-1,3,4-oxadiazol-2-yl]pentylazanium chloride |
| SMILES | [Cl-].[NH3+]CCCCCc1nnc(SCC(=O)Nc2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C15H19ClN4O2S.ClH/c16-11-5-4-6-12(9-11)18-13(21)10-23-15-20-19-14(22-15)7-2-1-3-8-17;/h4-6,9H,1-3,7-8,10,17H2,(H,18,21);1H |
| InChIKey | PEGNKGICDFJKAH-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|