C36H33NO8 — CID 44663262
[(4aR,6S,7R,8R,8aS)-7-[acetyl(benzoyl)amino]-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate (PubChem CID 44663262) has the molecular formula C36H33NO8 and a molecular weight of 607.66 g/mol. Its IUPAC name is [(4aR,6S,7R,8R,8aS)-7-[acetyl(benzoyl)amino]-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate.
| Compound Name | [(4aR,6S,7R,8R,8aS)-7-[acetyl(benzoyl)amino]-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
|---|---|
| PubChem CID | 44663262 |
| Molecular Formula | C36H33NO8 |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | [(4aR,6S,7R,8R,8aS)-7-[acetyl(benzoyl)amino]-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
| SMILES | CC(=O)N(C(=O)c1ccccc1)[C@H]1[C@@H](OCc2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H33NO8/c1-24(38)37(33(39)26-16-8-3-9-17-26)30-32(44-34(40)27-18-10-4-11-19-27)31-29(23-42-35(45-31)28-20-12-5-13-21-28)43-36(30)41-22-25-14-6-2-7-15-25/h2-21,29-32,35-36H,22-23H2,1H3/t29-,30-,31-,32-,35?,36+/m1/s1 |
| InChIKey | WWUBWKQCUKBTCI-LFUHMNMUSA-N |
| XLogP | 5.33 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |