C33H30N6O2S — CID 44665020
2-[[8-cyano-11,11-dimethyl-7-(4-methylanilino)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl]sulfanyl]-N,N-diphenylacetamide (PubChem CID 44665020) has the molecular formula C33H30N6O2S and a molecular weight of 574.71 g/mol. Its IUPAC name is 2-[[8-cyano-11,11-dimethyl-7-(4-methylanilino)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl]sulfanyl]-N,N-diphenylacetamide.
| Compound Name | 2-[[8-cyano-11,11-dimethyl-7-(4-methylanilino)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl]sulfanyl]-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 44665020 |
| Molecular Formula | C33H30N6O2S |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 2-[[8-cyano-11,11-dimethyl-7-(4-methylanilino)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl]sulfanyl]-N,N-diphenylacetamide |
| SMILES | Cc1ccc(Nc2c(C#N)c3c(c4nnc(SCC(=O)N(c5ccccc5)c5ccccc5)n24)COC(C)(C)C3)cc1 |
| InChI | InChI=1S/C33H30N6O2S/c1-22-14-16-23(17-15-22)35-30-27(19-34)26-18-33(2,3)41-20-28(26)31-36-37-32(39(30)31)42-21-29(40)38(24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-17,35H,18,20-21H2,1-3H3 |
| InChIKey | DBPSEQLBRFOJAS-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 95.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |