C33H31N5O6 — CID 44666078
1'-[2-(3,4-dimethoxyphenyl)ethyl]-5-methylspiro[1,3,9-triazapentacyclo[12.8.0.02,11.04,9.015,20]docosa-2(11),3,5,7,15,17,19-heptaene-13,5'-1,3-diazinane]-2',4',6',10-tetrone (PubChem CID 44666078) has the molecular formula C33H31N5O6 and a molecular weight of 593.64 g/mol. Its IUPAC name is 1'-[2-(3,4-dimethoxyphenyl)ethyl]-5-methylspiro[1,3,9-triazapentacyclo[12.8.0.02,11.04,9.015,20]docosa-2(11),3,5,7,15,17,19-heptaene-13,5'-1,3-diazinane]-2',4',6',10-tetrone.
| Compound Name | 1'-[2-(3,4-dimethoxyphenyl)ethyl]-5-methylspiro[1,3,9-triazapentacyclo[12.8.0.02,11.04,9.015,20]docosa-2(11),3,5,7,15,17,19-heptaene-13,5'-1,3-diazinane]-2',4',6',10-tetrone |
|---|---|
| PubChem CID | 44666078 |
| Molecular Formula | C33H31N5O6 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | 1'-[2-(3,4-dimethoxyphenyl)ethyl]-5-methylspiro[1,3,9-triazapentacyclo[12.8.0.02,11.04,9.015,20]docosa-2(11),3,5,7,15,17,19-heptaene-13,5'-1,3-diazinane]-2',4',6',10-tetrone |
| SMILES | COc1ccc(CCN2C(=O)NC(=O)C3(Cc4c(nc5c(C)cccn5c4=O)N4CCc5ccccc5C43)C2=O)cc1OC |
| InChI | InChI=1S/C33H31N5O6/c1-19-7-6-14-37-27(19)34-28-23(29(37)39)18-33(26-22-9-5-4-8-21(22)13-16-36(26)28)30(40)35-32(42)38(31(33)41)15-12-20-10-11-24(43-2)25(17-20)44-3/h4-11,14,17,26H,12-13,15-16,18H2,1-3H3,(H,35,40,42) |
| InChIKey | ZUOAONDVUWSROA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|