About [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride
[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride (PubChem CID 44666607) has the molecular formula C20H32ClNO3
and a molecular weight of 369.93 g/mol. Its IUPAC name is [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride.
Molecular Properties
| Compound Name | [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride |
| PubChem CID | 44666607 |
| Molecular Formula | C20H32ClNO3 |
| Molecular Weight | 369.93 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride |
| SMILES | CC(C)CCC(CC[NH2+]CC1CCCO1)c1ccc2c(c1)OCO2.[Cl-] |
| InChI | InChI=1S/C20H31NO3.ClH/c1-15(2)5-6-16(9-10-21-13-18-4-3-11-22-18)17-7-8-19-20(12-17)24-14-23-19;/h7-8,12,15-16,18,21H,3-6,9-11,13-14H2,1-2H3;1H |
| InChIKey | DPHOMRUHTXAIPQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.93 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride?
The IUPAC name of [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride (CID 44666607) is [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride.
What is the SMILES notation for [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride?
The canonical SMILES for [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride is CC(C)CCC(CC[NH2+]CC1CCCO1)c1ccc2c(c1)OCO2.[Cl-].
What is the InChIKey of [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride?
The InChIKey is DPHOMRUHTXAIPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31NO3.ClH/c1-15(2)5-6-16(9-10-21-13-18-4-3-11-22-18)17-7-8-19-20(12-17)24-14-23-19;/h7-8,12,15-16,18,21H,3-6,9-11,13-14H2,1-2H3;1H.
What are the key properties of [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride?
[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride has a molecular weight of 369.93 g/mol, XLogP of 0.07, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-benzodioxol-5-yl)-6-methylheptyl]-(oxolan-2-ylmethyl)azanium chloride is sourced from PubChem (CID 44666607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).