C23H22ClN3O5 — CID 44667197
1-[(4-chlorophenyl)-hydroxymethyl]-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 44667197) has the molecular formula C23H22ClN3O5 and a molecular weight of 455.90 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-hydroxymethyl]-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 1-[(4-chlorophenyl)-hydroxymethyl]-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 44667197 |
| Molecular Formula | C23H22ClN3O5 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 1-[(4-chlorophenyl)-hydroxymethyl]-5-(2-methoxyethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | COCCN1C(=O)C2C(C(O)c3ccc(Cl)cc3)NC3(C(=O)Nc4ccccc43)C2C1=O |
| InChI | InChI=1S/C23H22ClN3O5/c1-32-11-10-27-20(29)16-17(21(27)30)23(14-4-2-3-5-15(14)25-22(23)31)26-18(16)19(28)12-6-8-13(24)9-7-12/h2-9,16-19,26,28H,10-11H2,1H3,(H,25,31) |
| InChIKey | KEECINBCUAKNDE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|