About 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide
4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide (PubChem CID 44667549) has the molecular formula C19H21BrN2O2S
and a molecular weight of 421.36 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide |
| PubChem CID | 44667549 |
| Molecular Formula | C19H21BrN2O2S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide |
| SMILES | Br.CCCc1cc(-c2nc(-c3ccc(OC)c(OC)c3)cs2)ccn1 |
| InChI | InChI=1S/C19H20N2O2S.BrH/c1-4-5-15-10-14(8-9-20-15)19-21-16(12-24-19)13-6-7-17(22-2)18(11-13)23-3;/h6-12H,4-5H2,1-3H3;1H |
| InChIKey | NCKPNUPNSZYNJN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide?
The IUPAC name of 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide (CID 44667549) is 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide.
What is the SMILES notation for 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide?
The canonical SMILES for 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide is Br.CCCc1cc(-c2nc(-c3ccc(OC)c(OC)c3)cs2)ccn1.
What is the InChIKey of 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide?
The InChIKey is NCKPNUPNSZYNJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2S.BrH/c1-4-5-15-10-14(8-9-20-15)19-21-16(12-24-19)13-6-7-17(22-2)18(11-13)23-3;/h6-12H,4-5H2,1-3H3;1H.
What are the key properties of 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide?
4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide has a molecular weight of 421.36 g/mol, XLogP of 5.42, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxyphenyl)-2-(2-propyl-4-pyridinyl)-1,3-thiazole;hydrobromide is sourced from PubChem (CID 44667549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).