C23H28ClNO5 — CID 44667641
3-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)-4-phenylbutan-1-amine;oxalic acid (PubChem CID 44667641) has the molecular formula C23H28ClNO5 and a molecular weight of 433.93 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)-4-phenylbutan-1-amine;oxalic acid.
| Compound Name | 3-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)-4-phenylbutan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 44667641 |
| Molecular Formula | C23H28ClNO5 |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)-4-phenylbutan-1-amine;oxalic acid |
| SMILES | Clc1ccc(C(CCNCC2CCCO2)Cc2ccccc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H26ClNO.C2H2O4/c22-20-10-8-18(9-11-20)19(15-17-5-2-1-3-6-17)12-13-23-16-21-7-4-14-24-21;3-1(4)2(5)6/h1-3,5-6,8-11,19,21,23H,4,7,12-16H2;(H,3,4)(H,5,6) |
| InChIKey | GZEADKYFDRYHEW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|