About 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride
2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride (PubChem CID 44667857) has the molecular formula C8H11ClN2O3
and a molecular weight of 218.64 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride |
| PubChem CID | 44667857 |
| Molecular Formula | C8H11ClN2O3 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride |
| SMILES | Cc1cc(C)n(CC(=O)O)c(=O)n1.Cl |
| InChI | InChI=1S/C8H10N2O3.ClH/c1-5-3-6(2)10(4-7(11)12)8(13)9-5;/h3H,4H2,1-2H3,(H,11,12);1H |
| InChIKey | RBQZRNSVTXATNR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride?
The IUPAC name of 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride (CID 44667857) is 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride.
What is the SMILES notation for 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride?
The canonical SMILES for 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride is Cc1cc(C)n(CC(=O)O)c(=O)n1.Cl.
What is the InChIKey of 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride?
The InChIKey is RBQZRNSVTXATNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3.ClH/c1-5-3-6(2)10(4-7(11)12)8(13)9-5;/h3H,4H2,1-2H3,(H,11,12);1H.
What are the key properties of 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride?
2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride has a molecular weight of 218.64 g/mol, XLogP of 0.37, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetic acid;hydrochloride is sourced from PubChem (CID 44667857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).