C16H25ClN2O3 — CID 44668130
1,7,7-trimethyl-4-(4-methylpiperazine-1-carbonyl)bicyclo[2.2.1]heptane-2,3-dione;hydrochloride (PubChem CID 44668130) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is 1,7,7-trimethyl-4-(4-methylpiperazine-1-carbonyl)bicyclo[2.2.1]heptane-2,3-dione;hydrochloride.
| Compound Name | 1,7,7-trimethyl-4-(4-methylpiperazine-1-carbonyl)bicyclo[2.2.1]heptane-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 44668130 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1,7,7-trimethyl-4-(4-methylpiperazine-1-carbonyl)bicyclo[2.2.1]heptane-2,3-dione;hydrochloride |
| SMILES | CN1CCN(C(=O)C23CCC(C)(C(=O)C2=O)C3(C)C)CC1.Cl |
| InChI | InChI=1S/C16H24N2O3.ClH/c1-14(2)15(3)5-6-16(14,12(20)11(15)19)13(21)18-9-7-17(4)8-10-18;/h5-10H2,1-4H3;1H |
| InChIKey | PUMIDAMXWWHWDT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|