About (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride
(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride (PubChem CID 44668352) has the molecular formula C7H14ClNO
and a molecular weight of 163.65 g/mol. Its IUPAC name is (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride.
Molecular Properties
| Compound Name | (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride |
| PubChem CID | 44668352 |
| Molecular Formula | C7H14ClNO |
| Molecular Weight | 163.65 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride |
| SMILES | CN1CC=C(CO)CC1.Cl |
| InChI | InChI=1S/C7H13NO.ClH/c1-8-4-2-7(6-9)3-5-8;/h2,9H,3-6H2,1H3;1H |
| InChIKey | RPLQOTHNKDYSQH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.65 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride?
The IUPAC name of (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride (CID 44668352) is (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride.
What is the SMILES notation for (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride?
The canonical SMILES for (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride is CN1CC=C(CO)CC1.Cl.
What is the InChIKey of (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride?
The InChIKey is RPLQOTHNKDYSQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.ClH/c1-8-4-2-7(6-9)3-5-8;/h2,9H,3-6H2,1H3;1H.
What are the key properties of (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride?
(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride has a molecular weight of 163.65 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-3,6-dihydro-2H-pyridin-4-yl)methanol;hydrochloride is sourced from PubChem (CID 44668352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).