C31H28N4S2 — CID 44669355
2-[(2E,6E)-2,6-bis[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclohexylidene]propanedinitrile (PubChem CID 44669355) has the molecular formula C31H28N4S2 and a molecular weight of 520.73 g/mol. Its IUPAC name is 2-[(2E,6E)-2,6-bis[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclohexylidene]propanedinitrile.
| Compound Name | 2-[(2E,6E)-2,6-bis[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclohexylidene]propanedinitrile |
|---|---|
| PubChem CID | 44669355 |
| Molecular Formula | C31H28N4S2 |
| Molecular Weight | 520.73 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 2-[(2E,6E)-2,6-bis[(2Z)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)ethylidene]cyclohexylidene]propanedinitrile |
| SMILES | CCN1/C(=C/C=C2\CCC/C(=C\C=C3/Sc4ccccc4N3CC)C2=C(C#N)C#N)Sc2ccccc21 |
| InChI | InChI=1S/C31H28N4S2/c1-3-34-25-12-5-7-14-27(25)36-29(34)18-16-22-10-9-11-23(31(22)24(20-32)21-33)17-19-30-35(4-2)26-13-6-8-15-28(26)37-30/h5-8,12-19H,3-4,9-11H2,1-2H3/b22-16+,23-17+,29-18-,30-19- |
| InChIKey | AUNNOOXNARRSIW-INDCHUMNSA-N |
| XLogP | 8.31 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.73 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|