C15H17N5 — CID 44669478
tetramethylazanium;[(3E,5E)-2,8,8-tricyanoocta-1,3,5,7-tetraenylidene]azanide (PubChem CID 44669478) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is tetramethylazanium;[(3E,5E)-2,8,8-tricyanoocta-1,3,5,7-tetraenylidene]azanide.
| Compound Name | tetramethylazanium;[(3E,5E)-2,8,8-tricyanoocta-1,3,5,7-tetraenylidene]azanide |
|---|---|
| PubChem CID | 44669478 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | tetramethylazanium;[(3E,5E)-2,8,8-tricyanoocta-1,3,5,7-tetraenylidene]azanide |
| SMILES | C[N+](C)(C)C.N#CC(=C=[N-])/C=C/C=C/C=C(C#N)C#N |
| InChI | InChI=1S/C11H5N4.C4H12N/c12-6-10(7-13)4-2-1-3-5-11(8-14)9-15;1-5(2,3)4/h1-5H;1-4H3/q-1;+1/b2-1+,5-3+; |
| InChIKey | VBEMMDLOTLHWFP-OVYRSGNUSA-N |
| XLogP | 2.08 |
| TPSA | 93.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|