About 3-chlorobenzoic acid
3-chlorobenzoic acid (PubChem CID 447) has the molecular formula C7H5ClO2
and a molecular weight of 156.57 g/mol. Its IUPAC name is 3-chlorobenzoic acid.
Molecular Properties
| Compound Name | 3-chlorobenzoic acid |
| PubChem CID | 447 |
| Molecular Formula | C7H5ClO2 |
| Molecular Weight | 156.57 g/mol |
| Exact Mass | 156.00 |
| IUPAC Name | 3-chlorobenzoic acid |
| SMILES | O=C(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C7H5ClO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | LULAYUGMBFYYEX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzoic acid?
The IUPAC name of 3-chlorobenzoic acid (CID 447) is 3-chlorobenzoic acid.
What is the SMILES notation for 3-chlorobenzoic acid?
The canonical SMILES for 3-chlorobenzoic acid is O=C(O)c1cccc(Cl)c1.
What is the InChIKey of 3-chlorobenzoic acid?
The InChIKey is LULAYUGMBFYYEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10).
What are the key properties of 3-chlorobenzoic acid?
3-chlorobenzoic acid has a molecular weight of 156.57 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzoic acid is sourced from PubChem (CID 447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).