3-chlorobenzoic acid

C7H5ClO2 — CID 447

IUPAC3-chlorobenzoic acid
SMILESO=C(O)c1cccc(Cl)c1
InChIInChI=1S/C7H5ClO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10)
InChIKeyLULAYUGMBFYYEX-UHFFFAOYSA-N
MW156.57 g/mol
LogP2.04
Rot. Bonds1

About 3-chlorobenzoic acid

3-chlorobenzoic acid (PubChem CID 447) has the molecular formula C7H5ClO2 and a molecular weight of 156.57 g/mol. Its IUPAC name is 3-chlorobenzoic acid.

Molecular Properties

Compound Name3-chlorobenzoic acid
PubChem CID447
Molecular FormulaC7H5ClO2
Molecular Weight156.57 g/mol
Exact Mass156.00
IUPAC Name3-chlorobenzoic acid
SMILESO=C(O)c1cccc(Cl)c1
InChIInChI=1S/C7H5ClO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10)
InChIKeyLULAYUGMBFYYEX-UHFFFAOYSA-N
XLogP2.04
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.57
LogP ≤ 52.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-chlorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chlorobenzoic acid?
The IUPAC name of 3-chlorobenzoic acid (CID 447) is 3-chlorobenzoic acid.
What is the SMILES notation for 3-chlorobenzoic acid?
The canonical SMILES for 3-chlorobenzoic acid is O=C(O)c1cccc(Cl)c1.
What is the InChIKey of 3-chlorobenzoic acid?
The InChIKey is LULAYUGMBFYYEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10).
What are the key properties of 3-chlorobenzoic acid?
3-chlorobenzoic acid has a molecular weight of 156.57 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzoic acid is sourced from PubChem (CID 447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).