About 3,5-dihydroxydecanoic acid
3,5-dihydroxydecanoic acid (PubChem CID 44715204) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is 3,5-dihydroxydecanoic acid.
Molecular Properties
| Compound Name | 3,5-dihydroxydecanoic acid |
| PubChem CID | 44715204 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3,5-dihydroxydecanoic acid |
| SMILES | CCCCCC(O)CC(O)CC(=O)O |
| InChI | InChI=1S/C10H20O4/c1-2-3-4-5-8(11)6-9(12)7-10(13)14/h8-9,11-12H,2-7H2,1H3,(H,13,14) |
| InChIKey | WQZRAWSNEARGPQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dihydroxydecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydroxydecanoic acid?
The IUPAC name of 3,5-dihydroxydecanoic acid (CID 44715204) is 3,5-dihydroxydecanoic acid.
What is the SMILES notation for 3,5-dihydroxydecanoic acid?
The canonical SMILES for 3,5-dihydroxydecanoic acid is CCCCCC(O)CC(O)CC(=O)O.
What is the InChIKey of 3,5-dihydroxydecanoic acid?
The InChIKey is WQZRAWSNEARGPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-2-3-4-5-8(11)6-9(12)7-10(13)14/h8-9,11-12H,2-7H2,1H3,(H,13,14).
What are the key properties of 3,5-dihydroxydecanoic acid?
3,5-dihydroxydecanoic acid has a molecular weight of 204.27 g/mol, XLogP of 1.15, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydroxydecanoic acid is sourced from PubChem (CID 44715204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).