About 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate
2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate (PubChem CID 44715247) has the molecular formula C13H22O6
and a molecular weight of 274.31 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate |
| PubChem CID | 44715247 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate |
| SMILES | CC(=O)CC1CCC(C(C)C(=O)OCC(O)CO)O1 |
| InChI | InChI=1S/C13H22O6/c1-8(15)5-11-3-4-12(19-11)9(2)13(17)18-7-10(16)6-14/h9-12,14,16H,3-7H2,1-2H3 |
| InChIKey | MPUKHERSKPLKHP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate?
The IUPAC name of 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate (CID 44715247) is 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate.
What is the SMILES notation for 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate?
The canonical SMILES for 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate is CC(=O)CC1CCC(C(C)C(=O)OCC(O)CO)O1.
What is the InChIKey of 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate?
The InChIKey is MPUKHERSKPLKHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O6/c1-8(15)5-11-3-4-12(19-11)9(2)13(17)18-7-10(16)6-14/h9-12,14,16H,3-7H2,1-2H3.
What are the key properties of 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate?
2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate has a molecular weight of 274.31 g/mol, XLogP of 0.05, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl 2-[5-(2-oxopropyl)oxolan-2-yl]propanoate is sourced from PubChem (CID 44715247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).