C19H31N3 — CID 44716351
4-[[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methylamino]methyl]-N,N-dimethylaniline (PubChem CID 44716351) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is 4-[[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methylamino]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methylamino]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 44716351 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | 4-[[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methylamino]methyl]-N,N-dimethylaniline |
| SMILES | CC[C@H]1CN2CC[C@H]1C[C@@H]2CNCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H31N3/c1-4-16-14-22-10-9-17(16)11-19(22)13-20-12-15-5-7-18(8-6-15)21(2)3/h5-8,16-17,19-20H,4,9-14H2,1-3H3/t16-,17-,19+/m0/s1 |
| InChIKey | LRBSKRXXNDZCPJ-JENIJYKNSA-N |
| XLogP | 2.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|