C24H33N3O2S — CID 44716718
(2S)-2-[(4S,4aS,5S,8aS)-2-amino-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-benzyl-N-methylpropanamide (PubChem CID 44716718) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is (2S)-2-[(4S,4aS,5S,8aS)-2-amino-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-benzyl-N-methylpropanamide.
| Compound Name | (2S)-2-[(4S,4aS,5S,8aS)-2-amino-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-benzyl-N-methylpropanamide |
|---|---|
| PubChem CID | 44716718 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | (2S)-2-[(4S,4aS,5S,8aS)-2-amino-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-benzyl-N-methylpropanamide |
| SMILES | C[C@H](C(=O)N(C)Cc1ccccc1)C1CC[C@@]2(C)Cc3sc(N)nc3[C@@H](C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C24H33N3O2S/c1-14(22(29)27(4)13-16-8-6-5-7-9-16)17-10-11-24(3)12-18-20(26-23(25)30-18)15(2)19(24)21(17)28/h5-9,14-15,17,19,21,28H,10-13H2,1-4H3,(H2,25,26)/t14-,15-,17?,19+,21-,24-/m0/s1 |
| InChIKey | IZHUICWYNBIYDG-GRKNOJCVSA-N |
| XLogP | 4.07 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |