About N-cyclopropylaniline;hydrochloride
N-cyclopropylaniline;hydrochloride (PubChem CID 44717153) has the molecular formula C9H12ClN
and a molecular weight of 169.66 g/mol. Its IUPAC name is N-cyclopropylaniline;hydrochloride.
Molecular Properties
| Compound Name | N-cyclopropylaniline;hydrochloride |
| PubChem CID | 44717153 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.66 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | N-cyclopropylaniline;hydrochloride |
| SMILES | Cl.c1ccc(NC2CC2)cc1 |
| InChI | InChI=1S/C9H11N.ClH/c1-2-4-8(5-3-1)10-9-6-7-9;/h1-5,9-10H,6-7H2;1H |
| InChIKey | SMEWATLYUJNDOM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.66 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopropylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropylaniline;hydrochloride?
The IUPAC name of N-cyclopropylaniline;hydrochloride (CID 44717153) is N-cyclopropylaniline;hydrochloride.
What is the SMILES notation for N-cyclopropylaniline;hydrochloride?
The canonical SMILES for N-cyclopropylaniline;hydrochloride is Cl.c1ccc(NC2CC2)cc1.
What is the InChIKey of N-cyclopropylaniline;hydrochloride?
The InChIKey is SMEWATLYUJNDOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.ClH/c1-2-4-8(5-3-1)10-9-6-7-9;/h1-5,9-10H,6-7H2;1H.
What are the key properties of N-cyclopropylaniline;hydrochloride?
N-cyclopropylaniline;hydrochloride has a molecular weight of 169.66 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropylaniline;hydrochloride is sourced from PubChem (CID 44717153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).