C5H3CaF6O3+ — CID 44717257
calcium;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate;hydrate (PubChem CID 44717257) has the molecular formula C5H3CaF6O3+ and a molecular weight of 265.14 g/mol. Its IUPAC name is calcium;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate;hydrate.
| Compound Name | calcium;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate;hydrate |
|---|---|
| PubChem CID | 44717257 |
| Molecular Formula | C5H3CaF6O3+ |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.96 |
| IUPAC Name | calcium;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate;hydrate |
| SMILES | O.O=C(/C=C(\[O-])C(F)(F)F)C(F)(F)F.[Ca+2] |
| InChI | InChI=1S/C5H2F6O2.Ca.H2O/c6-4(7,8)2(12)1-3(13)5(9,10)11;;/h1,12H;;1H2/q;+2;/p-1/b2-1-;; |
| InChIKey | DEOJPWXJMFWIOO-UAIGNFCESA-M |
| XLogP | -0.28 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|