About 4,4,4-trifluorobutyl trifluoromethanesulfonate
4,4,4-trifluorobutyl trifluoromethanesulfonate (PubChem CID 44717369) has the molecular formula C5H6F6O3S
and a molecular weight of 260.15 g/mol. Its IUPAC name is 4,4,4-trifluorobutyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 4,4,4-trifluorobutyl trifluoromethanesulfonate |
| PubChem CID | 44717369 |
| Molecular Formula | C5H6F6O3S |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 4,4,4-trifluorobutyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCCCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H6F6O3S/c6-4(7,8)2-1-3-14-15(12,13)5(9,10)11/h1-3H2 |
| InChIKey | RBNDTPRHAUMXNY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 4,4,4-trifluorobutyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,4-trifluorobutyl trifluoromethanesulfonate?
The IUPAC name of 4,4,4-trifluorobutyl trifluoromethanesulfonate (CID 44717369) is 4,4,4-trifluorobutyl trifluoromethanesulfonate.
What is the SMILES notation for 4,4,4-trifluorobutyl trifluoromethanesulfonate?
The canonical SMILES for 4,4,4-trifluorobutyl trifluoromethanesulfonate is O=S(=O)(OCCCC(F)(F)F)C(F)(F)F.
What is the InChIKey of 4,4,4-trifluorobutyl trifluoromethanesulfonate?
The InChIKey is RBNDTPRHAUMXNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F6O3S/c6-4(7,8)2-1-3-14-15(12,13)5(9,10)11/h1-3H2.
What are the key properties of 4,4,4-trifluorobutyl trifluoromethanesulfonate?
4,4,4-trifluorobutyl trifluoromethanesulfonate has a molecular weight of 260.15 g/mol, XLogP of 2.20, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,4-trifluorobutyl trifluoromethanesulfonate is sourced from PubChem (CID 44717369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).