C6H10ClF5Si — CID 44717564
chloro-dimethyl-(3,3,4,4,4-pentafluorobutyl)silane (PubChem CID 44717564) has the molecular formula C6H10ClF5Si and a molecular weight of 240.67 g/mol. Its IUPAC name is chloro-dimethyl-(3,3,4,4,4-pentafluorobutyl)silane.
| Compound Name | chloro-dimethyl-(3,3,4,4,4-pentafluorobutyl)silane |
|---|---|
| PubChem CID | 44717564 |
| Molecular Formula | C6H10ClF5Si |
| Molecular Weight | 240.67 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | chloro-dimethyl-(3,3,4,4,4-pentafluorobutyl)silane |
| SMILES | C[Si](C)(Cl)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H10ClF5Si/c1-13(2,7)4-3-5(8,9)6(10,11)12/h3-4H2,1-2H3 |
| InChIKey | GMSMETLEXHMNHL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|