methyl 5-(butylsulfanylmethyl)furan-2-carboxylate

C11H16O3S — CID 44719010

IUPACmethyl 5-(butylsulfanylmethyl)furan-2-carboxylate
SMILESCCCCSCc1ccc(C(=O)OC)o1
InChIInChI=1S/C11H16O3S/c1-3-4-7-15-8-9-5-6-10(14-9)11(12)13-2/h5-6H,3-4,7-8H2,1-2H3
InChIKeyNVJYGCLLMJRVML-UHFFFAOYSA-N
MW228.31 g/mol
LogP3.10
Rot. Bonds6

About methyl 5-(butylsulfanylmethyl)furan-2-carboxylate

methyl 5-(butylsulfanylmethyl)furan-2-carboxylate (PubChem CID 44719010) has the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. Its IUPAC name is methyl 5-(butylsulfanylmethyl)furan-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-(butylsulfanylmethyl)furan-2-carboxylate
PubChem CID44719010
Molecular FormulaC11H16O3S
Molecular Weight228.31 g/mol
Exact Mass228.08
IUPAC Namemethyl 5-(butylsulfanylmethyl)furan-2-carboxylate
SMILESCCCCSCc1ccc(C(=O)OC)o1
InChIInChI=1S/C11H16O3S/c1-3-4-7-15-8-9-5-6-10(14-9)11(12)13-2/h5-6H,3-4,7-8H2,1-2H3
InChIKeyNVJYGCLLMJRVML-UHFFFAOYSA-N
XLogP3.10
TPSA39.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.31
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 5-(butylsulfanylmethyl)furan-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(butylsulfanylmethyl)furan-2-carboxylate?
The IUPAC name of methyl 5-(butylsulfanylmethyl)furan-2-carboxylate (CID 44719010) is methyl 5-(butylsulfanylmethyl)furan-2-carboxylate.
What is the SMILES notation for methyl 5-(butylsulfanylmethyl)furan-2-carboxylate?
The canonical SMILES for methyl 5-(butylsulfanylmethyl)furan-2-carboxylate is CCCCSCc1ccc(C(=O)OC)o1.
What is the InChIKey of methyl 5-(butylsulfanylmethyl)furan-2-carboxylate?
The InChIKey is NVJYGCLLMJRVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3S/c1-3-4-7-15-8-9-5-6-10(14-9)11(12)13-2/h5-6H,3-4,7-8H2,1-2H3.
What are the key properties of methyl 5-(butylsulfanylmethyl)furan-2-carboxylate?
methyl 5-(butylsulfanylmethyl)furan-2-carboxylate has a molecular weight of 228.31 g/mol, XLogP of 3.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(butylsulfanylmethyl)furan-2-carboxylate is sourced from PubChem (CID 44719010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).