C8H12O — CID 44719282
(3aS,7aR)-1,3,3a,4,5,7a-hexahydro-2-benzofuran (PubChem CID 44719282) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (3aS,7aR)-1,3,3a,4,5,7a-hexahydro-2-benzofuran.
| Compound Name | (3aS,7aR)-1,3,3a,4,5,7a-hexahydro-2-benzofuran |
|---|---|
| PubChem CID | 44719282 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (3aS,7aR)-1,3,3a,4,5,7a-hexahydro-2-benzofuran |
| SMILES | C1=C[C@H]2COC[C@H]2CC1 |
| InChI | InChI=1S/C8H12O/c1-2-4-8-6-9-5-7(8)3-1/h1,3,7-8H,2,4-6H2/t7-,8+/m0/s1 |
| InChIKey | HTGMLRPUGQRWDI-JGVFFNPUSA-N |
| XLogP | 1.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|