C10H16O4 — CID 44719745
(E)-3,6-diethoxyhex-5-ene-2,4-dione (PubChem CID 44719745) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (E)-3,6-diethoxyhex-5-ene-2,4-dione.
| Compound Name | (E)-3,6-diethoxyhex-5-ene-2,4-dione |
|---|---|
| PubChem CID | 44719745 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (E)-3,6-diethoxyhex-5-ene-2,4-dione |
| SMILES | CCO/C=C/C(=O)C(OCC)C(C)=O |
| InChI | InChI=1S/C10H16O4/c1-4-13-7-6-9(12)10(8(3)11)14-5-2/h6-7,10H,4-5H2,1-3H3/b7-6+ |
| InChIKey | BLTTUHWNGWAZQC-VOTSOKGWSA-N |
| XLogP | 1.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|