C30H14O4 — CID 44720480
heptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1,3(16),4(13),6,8,10,14,17,19(28),21,23,25,29-tridecaene-5,12,20,27-tetrone (PubChem CID 44720480) has the molecular formula C30H14O4 and a molecular weight of 438.44 g/mol. Its IUPAC name is heptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1,3(16),4(13),6,8,10,14,17,19(28),21,23,25,29-tridecaene-5,12,20,27-tetrone.
| Compound Name | heptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1,3(16),4(13),6,8,10,14,17,19(28),21,23,25,29-tridecaene-5,12,20,27-tetrone |
|---|---|
| PubChem CID | 44720480 |
| Molecular Formula | C30H14O4 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | heptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1,3(16),4(13),6,8,10,14,17,19(28),21,23,25,29-tridecaene-5,12,20,27-tetrone |
| SMILES | O=c1c2ccccc2c(=O)c2c1ccc1cc3c(ccc4c(=O)c5ccccc5c(=O)c43)cc12 |
| InChI | InChI=1S/C30H14O4/c31-27-17-5-1-3-7-19(17)29(33)25-21(27)11-9-15-14-24-16(13-23(15)25)10-12-22-26(24)30(34)20-8-4-2-6-18(20)28(22)32/h1-14H |
| InChIKey | VQZLNCZSYOUYEM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|