About 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one
2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one (PubChem CID 44721584) has the molecular formula C23H18N2O3
and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one.
Molecular Properties
| Compound Name | 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one |
| PubChem CID | 44721584 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one |
| SMILES | O=c1c2ccccc2c(-c2ccc3c(c2)OCCO3)nn1Cc1ccccc1 |
| InChI | InChI=1S/C23H18N2O3/c26-23-19-9-5-4-8-18(19)22(24-25(23)15-16-6-2-1-3-7-16)17-10-11-20-21(14-17)28-13-12-27-20/h1-11,14H,12-13,15H2 |
| InChIKey | JOWGORXFSWAPJZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one?
The IUPAC name of 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one (CID 44721584) is 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one.
What is the SMILES notation for 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one?
The canonical SMILES for 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one is O=c1c2ccccc2c(-c2ccc3c(c2)OCCO3)nn1Cc1ccccc1.
What is the InChIKey of 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one?
The InChIKey is JOWGORXFSWAPJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O3/c26-23-19-9-5-4-8-18(19)22(24-25(23)15-16-6-2-1-3-7-16)17-10-11-20-21(14-17)28-13-12-27-20/h1-11,14H,12-13,15H2.
What are the key properties of 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one?
2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one has a molecular weight of 370.41 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)phthalazin-1-one is sourced from PubChem (CID 44721584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).