About 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate
1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate (PubChem CID 44721827) has the molecular formula C14H15Br2NO2
and a molecular weight of 389.09 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate |
| PubChem CID | 44721827 |
| Molecular Formula | C14H15Br2NO2 |
| Molecular Weight | 389.09 g/mol |
| Exact Mass | 386.95 |
| IUPAC Name | 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate |
| SMILES | CC(C(=O)c1ccc(Br)cc1)[n+]1ccccc1.O.[Br-] |
| InChI | InChI=1S/C14H13BrNO.BrH.H2O/c1-11(16-9-3-2-4-10-16)14(17)12-5-7-13(15)8-6-12;;/h2-11H,1H3;1H;1H2/q+1;;/p-1 |
| InChIKey | KRXNHDZEBPOWLR-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 52.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.09 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate?
The IUPAC name of 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate (CID 44721827) is 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate.
What is the SMILES notation for 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate?
The canonical SMILES for 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate is CC(C(=O)c1ccc(Br)cc1)[n+]1ccccc1.O.[Br-].
What is the InChIKey of 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate?
The InChIKey is KRXNHDZEBPOWLR-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H13BrNO.BrH.H2O/c1-11(16-9-3-2-4-10-16)14(17)12-5-7-13(15)8-6-12;;/h2-11H,1H3;1H;1H2/q+1;;/p-1.
What are the key properties of 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate?
1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate has a molecular weight of 389.09 g/mol, XLogP of -0.64, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylpropan-1-one;bromide;hydrate is sourced from PubChem (CID 44721827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).