About [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate
[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate (PubChem CID 44722141) has the molecular formula C4H13NO7S
and a molecular weight of 219.21 g/mol. Its IUPAC name is [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate.
Molecular Properties
| Compound Name | [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate |
| PubChem CID | 44722141 |
| Molecular Formula | C4H13NO7S |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate |
| SMILES | O=S(=O)([O-])O.[NH3+]C(CO)(CO)CO |
| InChI | InChI=1S/C4H11NO3.H2O4S/c5-4(1-6,2-7)3-8;1-5(2,3)4/h6-8H,1-3,5H2;(H2,1,2,3,4) |
| InChIKey | AXRFNWFXORHARM-UHFFFAOYSA-N |
| XLogP | -4.05 |
| TPSA | 165.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate?
The IUPAC name of [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate (CID 44722141) is [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate.
What is the SMILES notation for [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate?
The canonical SMILES for [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate is O=S(=O)([O-])O.[NH3+]C(CO)(CO)CO.
What is the InChIKey of [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate?
The InChIKey is AXRFNWFXORHARM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO3.H2O4S/c5-4(1-6,2-7)3-8;1-5(2,3)4/h6-8H,1-3,5H2;(H2,1,2,3,4).
What are the key properties of [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate?
[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate has a molecular weight of 219.21 g/mol, XLogP of -4.05, 3 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]azanium;hydrogen sulfate is sourced from PubChem (CID 44722141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).