C14H22N2O2 — CID 44722433
2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate (PubChem CID 44722433) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate.
| Compound Name | 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate |
|---|---|
| PubChem CID | 44722433 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate |
| SMILES | CCc1cccc(C)c1NC(=O)OCCN(C)C |
| InChI | InChI=1S/C14H22N2O2/c1-5-12-8-6-7-11(2)13(12)15-14(17)18-10-9-16(3)4/h6-8H,5,9-10H2,1-4H3,(H,15,17) |
| InChIKey | VODKONMIOKKKET-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |