2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate

C14H22N2O2 — CID 44722433

IUPAC2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate
SMILESCCc1cccc(C)c1NC(=O)OCCN(C)C
InChIInChI=1S/C14H22N2O2/c1-5-12-8-6-7-11(2)13(12)15-14(17)18-10-9-16(3)4/h6-8H,5,9-10H2,1-4H3,(H,15,17)
InChIKeyVODKONMIOKKKET-UHFFFAOYSA-N
MW250.34 g/mol
LogP2.67
Rot. Bonds5

About 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate

2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate (PubChem CID 44722433) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate.

Molecular Properties

Compound Name2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate
PubChem CID44722433
Molecular FormulaC14H22N2O2
Molecular Weight250.34 g/mol
Exact Mass250.17
IUPAC Name2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate
SMILESCCc1cccc(C)c1NC(=O)OCCN(C)C
InChIInChI=1S/C14H22N2O2/c1-5-12-8-6-7-11(2)13(12)15-14(17)18-10-9-16(3)4/h6-8H,5,9-10H2,1-4H3,(H,15,17)
InChIKeyVODKONMIOKKKET-UHFFFAOYSA-N
XLogP2.67
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.34
LogP ≤ 52.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate?
The IUPAC name of 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate (CID 44722433) is 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate.
What is the SMILES notation for 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate?
The canonical SMILES for 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate is CCc1cccc(C)c1NC(=O)OCCN(C)C.
What is the InChIKey of 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate?
The InChIKey is VODKONMIOKKKET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c1-5-12-8-6-7-11(2)13(12)15-14(17)18-10-9-16(3)4/h6-8H,5,9-10H2,1-4H3,(H,15,17).
What are the key properties of 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate?
2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate has a molecular weight of 250.34 g/mol, XLogP of 2.67, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl N-(2-ethyl-6-methylphenyl)carbamate is sourced from PubChem (CID 44722433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).