About 2,2-bis(2-methoxyethyl)-1,3-dithiane
2,2-bis(2-methoxyethyl)-1,3-dithiane (PubChem CID 44722564) has the molecular formula C10H20O2S2
and a molecular weight of 236.40 g/mol. Its IUPAC name is 2,2-bis(2-methoxyethyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 2,2-bis(2-methoxyethyl)-1,3-dithiane |
| PubChem CID | 44722564 |
| Molecular Formula | C10H20O2S2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2,2-bis(2-methoxyethyl)-1,3-dithiane |
| SMILES | COCCC1(CCOC)SCCCS1 |
| InChI | InChI=1S/C10H20O2S2/c1-11-6-4-10(5-7-12-2)13-8-3-9-14-10/h3-9H2,1-2H3 |
| InChIKey | HGEASEGNAURSRA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-bis(2-methoxyethyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(2-methoxyethyl)-1,3-dithiane?
The IUPAC name of 2,2-bis(2-methoxyethyl)-1,3-dithiane (CID 44722564) is 2,2-bis(2-methoxyethyl)-1,3-dithiane.
What is the SMILES notation for 2,2-bis(2-methoxyethyl)-1,3-dithiane?
The canonical SMILES for 2,2-bis(2-methoxyethyl)-1,3-dithiane is COCCC1(CCOC)SCCCS1.
What is the InChIKey of 2,2-bis(2-methoxyethyl)-1,3-dithiane?
The InChIKey is HGEASEGNAURSRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2S2/c1-11-6-4-10(5-7-12-2)13-8-3-9-14-10/h3-9H2,1-2H3.
What are the key properties of 2,2-bis(2-methoxyethyl)-1,3-dithiane?
2,2-bis(2-methoxyethyl)-1,3-dithiane has a molecular weight of 236.40 g/mol, XLogP of 2.63, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2-methoxyethyl)-1,3-dithiane is sourced from PubChem (CID 44722564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).