C27H26N4O2 — CID 44722959
N-[(E)-1-(4-methylphenyl)ethylideneamino]-2-[4-methyl-2-(2-phenylpyrazol-3-yl)phenoxy]acetamide (PubChem CID 44722959) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[(E)-1-(4-methylphenyl)ethylideneamino]-2-[4-methyl-2-(2-phenylpyrazol-3-yl)phenoxy]acetamide.
| Compound Name | N-[(E)-1-(4-methylphenyl)ethylideneamino]-2-[4-methyl-2-(2-phenylpyrazol-3-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 44722959 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-[(E)-1-(4-methylphenyl)ethylideneamino]-2-[4-methyl-2-(2-phenylpyrazol-3-yl)phenoxy]acetamide |
| SMILES | C/C(=N\NC(=O)COc1ccc(C)cc1-c1ccnn1-c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H26N4O2/c1-19-9-12-22(13-10-19)21(3)29-30-27(32)18-33-26-14-11-20(2)17-24(26)25-15-16-28-31(25)23-7-5-4-6-8-23/h4-17H,18H2,1-3H3,(H,30,32)/b29-21+ |
| InChIKey | XTVBPWFFQMBBQT-XHLNEMQHSA-N |
| XLogP | 5.08 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|