C18H15N3O3 — CID 44722987
N-[(E)-benzylideneamino]-2-[2-(1,2-oxazol-5-yl)phenoxy]acetamide (PubChem CID 44722987) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2-[2-(1,2-oxazol-5-yl)phenoxy]acetamide.
| Compound Name | N-[(E)-benzylideneamino]-2-[2-(1,2-oxazol-5-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 44722987 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[(E)-benzylideneamino]-2-[2-(1,2-oxazol-5-yl)phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1-c1ccno1)N/N=C/c1ccccc1 |
| InChI | InChI=1S/C18H15N3O3/c22-18(21-19-12-14-6-2-1-3-7-14)13-23-16-9-5-4-8-15(16)17-10-11-20-24-17/h1-12H,13H2,(H,21,22)/b19-12+ |
| InChIKey | AYBDZYCUEFNQIN-XDHOZWIPSA-N |
| XLogP | 2.87 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|