About (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol
(1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol (PubChem CID 44723444) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol.
Molecular Properties
| Compound Name | (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol |
| PubChem CID | 44723444 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol |
| SMILES | OC1C[C@H]2C[C@@H]1C1C=CCC12 |
| InChI | InChI=1S/C10H14O/c11-10-5-6-4-9(10)8-3-1-2-7(6)8/h1,3,6-11H,2,4-5H2/t6-,7?,8?,9-,10?/m1/s1 |
| InChIKey | LDUKQFUHJZHLRC-QUFPLUETSA-N |
| XLogP | 1.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol?
The IUPAC name of (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol (CID 44723444) is (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol.
What is the SMILES notation for (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol?
The canonical SMILES for (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol is OC1C[C@H]2C[C@@H]1C1C=CCC12.
What is the InChIKey of (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol?
The InChIKey is LDUKQFUHJZHLRC-QUFPLUETSA-N. The full InChI is InChI=1S/C10H14O/c11-10-5-6-4-9(10)8-3-1-2-7(6)8/h1,3,6-11H,2,4-5H2/t6-,7?,8?,9-,10?/m1/s1.
What are the key properties of (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol?
(1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol has a molecular weight of 150.22 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,7R)-tricyclo[5.2.1.02,6]dec-4-en-8-ol is sourced from PubChem (CID 44723444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).