C23H32N4O3 — CID 44723679
(16-acetyloxy-9,13-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-diene-8-carbonyl)azaniumylideneazanide (PubChem CID 44723679) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is (16-acetyloxy-9,13-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-diene-8-carbonyl)azaniumylideneazanide.
| Compound Name | (16-acetyloxy-9,13-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-diene-8-carbonyl)azaniumylideneazanide |
|---|---|
| PubChem CID | 44723679 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (16-acetyloxy-9,13-dimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-diene-8-carbonyl)azaniumylideneazanide |
| SMILES | CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C3CC3CN=NC32C(=O)[NH+]=[N-])C1 |
| InChI | InChI=1S/C23H32N4O3/c1-13(28)30-16-6-8-21(2)14(10-16)4-5-17-18(21)7-9-22(3)19(17)11-15-12-25-27-23(15,22)20(29)26-24/h4,15-19,26H,5-12H2,1-3H3 |
| InChIKey | ZWNXFYOFKYYMST-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|